ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39905-44-7 p-Heptyloxyaniline |
|
نام محصول | p-Heptyloxyaniline |
نام انگلیسی | p-Heptyloxyaniline;4-n-Heptyloxyaniline;4-(heptyloxy)aniline |
میدان مغناطیسی | C13H21NO |
وزن مولکولی | 207.3119 |
InChI | InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
شماره سیایاس | 39905-44-7 |
ساختار مولکولی | ![]() |
تراکم | 0.965g/cm3 |
نقطه غلیان | 325.9°C at 760 mmHg |
ضریب شکست | 1.516 |
نقطه اشتعال | 145°C |
فشار بخار | 0.000223mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |