ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39905-44-7 p-Heptyloxyaniline |
|
उत्पाद का नाम | p-Heptyloxyaniline |
अंग्रेज | p-Heptyloxyaniline;4-n-Heptyloxyaniline;4-(heptyloxy)aniline |
आणविक फार्मूला | C13H21NO |
आण्विक वजन | 207.3119 |
InChI | InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
कैस रजिस्टी संख्या | 39905-44-7 |
आणविक संरचना | ![]() |
घनत्व | 0.965g/cm3 |
उबलने का समय | 325.9°C at 760 mmHg |
अपवर्तक सूचकांक | 1.516 |
फ्लैश प्वाइंट | 145°C |
वाष्प का दबाव | 0.000223mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |