ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39905-44-7 p-Heptyloxyaniline |
|
Nama produk | p-Heptyloxyaniline |
Nama bahasa Inggris | p-Heptyloxyaniline;4-n-Heptyloxyaniline;4-(heptyloxy)aniline |
MF | C13H21NO |
Berat Molekul | 207.3119 |
InChI | InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
CAS NO | 39905-44-7 |
Struktur Molekul | ![]() |
Kepadatan | 0.965g/cm3 |
Titik didih | 325.9°C at 760 mmHg |
Indeks bias | 1.516 |
Titik nyala | 145°C |
Tekanan uap | 0.000223mmHg at 25°C |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Deskripsi | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |