ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
|
termék neve | 2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
Angol név | 2,3-dihydro-1,4-benzodioxine-6-carbothioamide;2,3-dihydro-4-Benzodioxin-6-carbothioamide |
MF | C9H9NO2S |
Molekulatömeg | 195.2383 |
InChI | InChI=1/C9H9NO2S/c10-9(13)6-1-2-7-8(5-6)12-4-3-11-7/h1-2,5H,3-4H2,(H2,10,13) |
CAS-szám | 337508-71-1 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.347g/cm3 |
Olvadáspont | 140.2℃ |
Forráspont | 339.2°C at 760 mmHg |
Törésmutató | 1.655 |
Gyulladáspont | 158.9°C |
Gőznyomás | 9.35E-05mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |