ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
|
Naam product | 2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
Engelse naam | 2,3-dihydro-1,4-benzodioxine-6-carbothioamide;2,3-dihydro-4-Benzodioxin-6-carbothioamide |
MF | C9H9NO2S |
Molecuulgewicht | 195.2383 |
InChI | InChI=1/C9H9NO2S/c10-9(13)6-1-2-7-8(5-6)12-4-3-11-7/h1-2,5H,3-4H2,(H2,10,13) |
CAS-nummer | 337508-71-1 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.347g/cm3 |
Smeltpunt | 140.2℃ |
Kookpunt | 339.2°C at 760 mmHg |
Brekingsindex | 1.655 |
Vlampunt | 158.9°C |
Dampdruk | 9.35E-05mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Veiligheid Omschrijving | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |