Chemindex > 337508-71-1
KR ▼
337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
|
| 상품명칭 | 2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
| 영문 이름 | 2,3-dihydro-1,4-benzodioxine-6-carbothioamide;2,3-dihydro-4-Benzodioxin-6-carbothioamide |
| 분자식 | C9H9NO2S |
| 분자량 | 195.2383 |
| InChI | InChI=1/C9H9NO2S/c10-9(13)6-1-2-7-8(5-6)12-4-3-11-7/h1-2,5H,3-4H2,(H2,10,13) |
| cas번호 | 337508-71-1 |
| 분자 구조 |  |
| 밀도 | 1.347g/cm3 |
| 녹는 점 | 140.2℃ |
| 비등점 | 339.2°C at 760 mmHg |
| 굴절 지수 | 1.655 |
| 인화점 | 158.9°C |
| 증기압 | 9.35E-05mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
337508-71-1 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 