ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
|
produktnavn | 2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
Engelsk navn | 2,3-dihydro-1,4-benzodioxine-6-carbothioamide;2,3-dihydro-4-Benzodioxin-6-carbothioamide |
Molekylær Formel | C9H9NO2S |
Molekylvekt | 195.2383 |
InChI | InChI=1/C9H9NO2S/c10-9(13)6-1-2-7-8(5-6)12-4-3-11-7/h1-2,5H,3-4H2,(H2,10,13) |
CAS-nummer | 337508-71-1 |
Molecular Structure | ![]() |
Tetthet | 1.347g/cm3 |
Smeltepunkt | 140.2℃ |
Kokepunkt | 339.2°C at 760 mmHg |
Brytningsindeks | 1.655 |
Flammepunktet | 158.9°C |
Damptrykk | 9.35E-05mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |