ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38076-82-3 2-Amino-4-methylnicotinic acid |
|
termék neve | 2-Amino-4-methylnicotinic acid |
Angol név | 2-Amino-4-methylnicotinic acid;2-amino-4-methylpyridine-3-carboxylic acid |
MF | C7H8N2O2 |
Molekulatömeg | 152.1506 |
InChI | InChI=1/C7H8N2O2/c1-4-2-3-9-6(8)5(4)7(10)11/h2-3H,1H3,(H2,8,9)(H,10,11) |
CAS-szám | 38076-82-3 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.337g/cm3 |
Forráspont | 347.8°C at 760 mmHg |
Törésmutató | 1.627 |
Gyulladáspont | 164.1°C |
Gőznyomás | 1.98E-05mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |