ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38076-82-3 2-Amino-4-methylnicotinic acid |
|
상품명칭 | 2-Amino-4-methylnicotinic acid |
영문 이름 | 2-Amino-4-methylnicotinic acid;2-amino-4-methylpyridine-3-carboxylic acid |
분자식 | C7H8N2O2 |
분자량 | 152.1506 |
InChI | InChI=1/C7H8N2O2/c1-4-2-3-9-6(8)5(4)7(10)11/h2-3H,1H3,(H2,8,9)(H,10,11) |
cas번호 | 38076-82-3 |
분자 구조 | ![]() |
밀도 | 1.337g/cm3 |
비등점 | 347.8°C at 760 mmHg |
굴절 지수 | 1.627 |
인화점 | 164.1°C |
증기압 | 1.98E-05mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |