ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38076-82-3 2-Amino-4-methylnicotinic acid |
|
Nama produk | 2-Amino-4-methylnicotinic acid |
Nama bahasa Inggris | 2-Amino-4-methylnicotinic acid;2-amino-4-methylpyridine-3-carboxylic acid |
MF | C7H8N2O2 |
Berat Molekul | 152.1506 |
InChI | InChI=1/C7H8N2O2/c1-4-2-3-9-6(8)5(4)7(10)11/h2-3H,1H3,(H2,8,9)(H,10,11) |
CAS NO | 38076-82-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.337g/cm3 |
Titik didih | 347.8°C at 760 mmHg |
Indeks bias | 1.627 |
Titik nyala | 164.1°C |
Tekanan uap | 1.98E-05mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |