ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38076-82-3 2-Amino-4-methylnicotinic acid |
|
उत्पाद का नाम | 2-Amino-4-methylnicotinic acid |
अंग्रेज | 2-Amino-4-methylnicotinic acid;2-amino-4-methylpyridine-3-carboxylic acid |
आणविक फार्मूला | C7H8N2O2 |
आण्विक वजन | 152.1506 |
InChI | InChI=1/C7H8N2O2/c1-4-2-3-9-6(8)5(4)7(10)11/h2-3H,1H3,(H2,8,9)(H,10,11) |
कैस रजिस्टी संख्या | 38076-82-3 |
आणविक संरचना | ![]() |
घनत्व | 1.337g/cm3 |
उबलने का समय | 347.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.627 |
फ्लैश प्वाइंट | 164.1°C |
वाष्प का दबाव | 1.98E-05mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |