ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39827-12-8 1-benzotiofén-3-karbonil-klorid |
|
termék neve | 1-benzotiofén-3-karbonil-klorid |
Angol név | 1-benzothiophene-3-carbonyl chloride; |
MF | C9H5ClOS |
Molekulatömeg | 196.6534 |
InChI | InChI=1/C9H5ClOS/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H |
CAS-szám | 39827-12-8 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.41g/cm3 |
Forráspont | 309.5°C at 760 mmHg |
Törésmutató | 1.68 |
Gyulladáspont | 141°C |
Gőznyomás | 0.000636mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R34##Causes burns.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |