ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39827-12-8 1-benzotiofen-3-karbonylklorid |
|
produktnavn | 1-benzotiofen-3-karbonylklorid |
Engelsk navn | 1-benzothiophene-3-carbonyl chloride; |
Molekylær Formel | C9H5ClOS |
Molekylvekt | 196.6534 |
InChI | InChI=1/C9H5ClOS/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H |
CAS-nummer | 39827-12-8 |
Molecular Structure | ![]() |
Tetthet | 1.41g/cm3 |
Kokepunkt | 309.5°C at 760 mmHg |
Brytningsindeks | 1.68 |
Flammepunktet | 141°C |
Damptrykk | 0.000636mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |