ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39827-12-8 1-benzotiyofen-3-karbonil klorür |
|
Ürün Adı | 1-benzotiyofen-3-karbonil klorür |
Eş anlamlı | |
ingilizce adı | 1-benzothiophene-3-carbonyl chloride; |
Moleküler Formülü | C9H5ClOS |
Molekül Ağırlığı | 196.6534 |
InChI | InChI=1/C9H5ClOS/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H |
CAS kayıt numarası | 39827-12-8 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.41g/cm3 |
Kaynama noktası | 309.5°C at 760 mmHg |
Kırılma indisi | 1.68 |
Alevlenme noktası | 141°C |
Buhar basıncı | 0.000636mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |