ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39827-12-8 1-بنزوثيوفين-3-كلوريد الكربونيل ؛ |
|
اسم المنتج | 1-بنزوثيوفين-3-كلوريد الكربونيل ؛ |
الاسم بالانجليزية | 1-benzothiophene-3-carbonyl chloride; |
الصيغة الجزيئية | C9H5ClOS |
الوزن الجزيئي الغرامي | 196.6534 |
InChI | InChI=1/C9H5ClOS/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H |
إستراتيجية المساعدة القطرية | 39827-12-8 |
بنية جزيئية | ![]() |
كثافة | 1.41g/cm3 |
نقطة الغليان | 309.5°C at 760 mmHg |
معامل الإنكسار | 1.68 |
نقطة الوميض | 141°C |
ضغط البخار | 0.000636mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |