ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4740-22-1 2-amino-1-(4-nitrofenil)etán-1-on-hidroklorid-hidrát |
|
| termék neve | 2-amino-1-(4-nitrofenil)etán-1-on-hidroklorid-hidrát |
| Szinonimák | 2-amino-1-(4-nitrofenil)etanon-hidroklorid-hidrát; |
| Angol név | 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate;2-amino-1-(4-nitrophenyl)ethanone hydrochloride hydrate |
| MF | C8H11ClN2O4 |
| Molekulatömeg | 234.6369 |
| InChI | InChI=1/C8H8N2O3.ClH.H2O/c9-5-8(11)6-1-3-7(4-2-6)10(12)13;;/h1-4H,5,9H2;1H;1H2 |
| CAS-szám | 4740-22-1 |
| Molekuláris szerkezete | ![]() |
| Olvadáspont | 134℃ |
| Forráspont | 339.1°C at 760 mmHg |
| Gyulladáspont | 158.9°C |
| Gőznyomás | 9.39E-05mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R34##Causes burns.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |