ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4740-22-1 2-ammino-1-(4-nitrofenil)etano-1-one cloridrato idrato |
|
| Nome del prodotto | 2-ammino-1-(4-nitrofenil)etano-1-one cloridrato idrato |
| Sinonimi | 2-ammino-1-(4-nitrofenil)etano cloridrato idrato; |
| Nome inglese | 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate;2-amino-1-(4-nitrophenyl)ethanone hydrochloride hydrate |
| Formula molecolare | C8H11ClN2O4 |
| Peso Molecolare | 234.6369 |
| InChI | InChI=1/C8H8N2O3.ClH.H2O/c9-5-8(11)6-1-3-7(4-2-6)10(12)13;;/h1-4H,5,9H2;1H;1H2 |
| Numero CAS | 4740-22-1 |
| Struttura molecolare | ![]() |
| Punto di fusione | 134℃ |
| Punto di ebollizione | 339.1°C at 760 mmHg |
| Punto d'infiammabilità | 158.9°C |
| Pressione di vapore | 9.39E-05mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R34##Causes burns.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |