Chemindex >4740-22-1
MY ▼
4740-22-1 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate |
|
| Nama produk | 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate |
| Sinonim | 2-amino-1-(4-nitrophenyl)hidrat hidroklorida ethanone; |
| Nama Inggeris | 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate;2-amino-1-(4-nitrophenyl)ethanone hydrochloride hydrate |
| MF | C8H11ClN2O4 |
| Berat Molekul | 234.6369 |
| InChI | InChI=1/C8H8N2O3.ClH.H2O/c9-5-8(11)6-1-3-7(4-2-6)10(12)13;;/h1-4H,5,9H2;1H;1H2 |
| CAS NO | 4740-22-1 |
| Struktur Molekul |  |
| Titik lebur | 134℃ |
| Titik didih | 339.1°C at 760 mmHg |
| Titik nyala | 158.9°C |
| Tekanan wap | 9.39E-05mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 