ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4740-22-1 2-amino-1- (4-nitrofenil) etan-1-on hidroklorür hidrat |
|
| Ürün Adı | 2-amino-1- (4-nitrofenil) etan-1-on hidroklorür hidrat |
| Eş anlamlı | 2-amino-1- (4-nitrofenil) etankon hidroklorür hidrat; |
| ingilizce adı | 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate;2-amino-1-(4-nitrophenyl)ethanone hydrochloride hydrate |
| Moleküler Formülü | C8H11ClN2O4 |
| Molekül Ağırlığı | 234.6369 |
| InChI | InChI=1/C8H8N2O3.ClH.H2O/c9-5-8(11)6-1-3-7(4-2-6)10(12)13;;/h1-4H,5,9H2;1H;1H2 |
| CAS kayıt numarası | 4740-22-1 |
| Moleküler Yapısı | ![]() |
| Ergime noktası | 134℃ |
| Kaynama noktası | 339.1°C at 760 mmHg |
| Alevlenme noktası | 158.9°C |
| Buhar basıncı | 9.39E-05mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R34##Causes burns.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |