ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51707-38-1 3,4-Dimethoxybenzhydrazide |
|
termék neve | 3,4-Dimethoxybenzhydrazide |
Angol név | 3,4-Dimethoxybenzhydrazide;3,5-dimethoxybenzohydrazide;3,5-Dimethoxybenzhydrazide |
MF | C9H12N2O3 |
Molekulatömeg | 196.2032 |
InChI | InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
CAS-szám | 51707-38-1 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.189g/cm3 |
Olvadáspont | 143-144℃ |
Törésmutató | 1.544 |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |