ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51707-38-1 3,4-Dimethoxybenzhydrazide |
|
produktnavn | 3,4-Dimethoxybenzhydrazide |
Engelsk navn | 3,4-Dimethoxybenzhydrazide;3,5-dimethoxybenzohydrazide;3,5-Dimethoxybenzhydrazide |
Molekylær Formel | C9H12N2O3 |
Molekylvekt | 196.2032 |
InChI | InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
CAS-nummer | 51707-38-1 |
Molecular Structure | ![]() |
Tetthet | 1.189g/cm3 |
Smeltepunkt | 143-144℃ |
Brytningsindeks | 1.544 |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |