ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51707-38-1 3,4-Dimethoxybenzhydrazide |
|
| نام محصول | 3,4-Dimethoxybenzhydrazide |
| نام انگلیسی | 3,4-Dimethoxybenzhydrazide;3,5-dimethoxybenzohydrazide;3,5-Dimethoxybenzhydrazide |
| میدان مغناطیسی | C9H12N2O3 |
| وزن مولکولی | 196.2032 |
| InChI | InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
| شماره سیایاس | 51707-38-1 |
| ساختار مولکولی | ![]() |
| تراکم | 1.189g/cm3 |
| نقطه ذوب | 143-144℃ |
| ضریب شکست | 1.544 |
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |