ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51707-38-1 3,4-Dimethoxybenzhydrazide |
|
اسم المنتج | 3,4-Dimethoxybenzhydrazide |
الاسم بالانجليزية | 3,4-Dimethoxybenzhydrazide;3,5-dimethoxybenzohydrazide;3,5-Dimethoxybenzhydrazide |
الصيغة الجزيئية | C9H12N2O3 |
الوزن الجزيئي الغرامي | 196.2032 |
InChI | InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
إستراتيجية المساعدة القطرية | 51707-38-1 |
بنية جزيئية | ![]() |
كثافة | 1.189g/cm3 |
درجة الإنصهار | 143-144℃ |
معامل الإنكسار | 1.544 |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |