ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5326-38-5 2-Iodo-5-nitrotoluene |
|
| termék neve | 2-Iodo-5-nitrotoluene |
| Angol név | 2-Iodo-5-nitrotoluene;1-iodo-2-methyl-4-nitrobenzene;N-(1-methylethyl)phenazine-1-carboxamide |
| MF | C16H15N3O |
| Molekulatömeg | 265.3098 |
| InChI | InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
| CAS-szám | 5326-38-5 |
| EINECS | 226-204-1 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.217g/cm3 |
| Forráspont | 531.5°C at 760 mmHg |
| Törésmutató | 1.665 |
| Gyulladáspont | 275.2°C |
| Gőznyomás | 2.23E-11mmHg at 25°C |
| Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |