ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5326-38-5 2-Iodo-5-nitrotoluene |
|
| Nome del prodotto | 2-Iodo-5-nitrotoluene |
| Nome inglese | 2-Iodo-5-nitrotoluene;1-iodo-2-methyl-4-nitrobenzene;N-(1-methylethyl)phenazine-1-carboxamide |
| Formula molecolare | C16H15N3O |
| Peso Molecolare | 265.3098 |
| InChI | InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
| Numero CAS | 5326-38-5 |
| EINECS | 226-204-1 |
| Struttura molecolare | ![]() |
| Densità | 1.217g/cm3 |
| Punto di ebollizione | 531.5°C at 760 mmHg |
| Indice di rifrazione | 1.665 |
| Punto d'infiammabilità | 275.2°C |
| Pressione di vapore | 2.23E-11mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |