ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5326-38-5 2-Iodo-5-nitrotoluene |
|
| उत्पाद का नाम | 2-Iodo-5-nitrotoluene |
| अंग्रेज | 2-Iodo-5-nitrotoluene;1-iodo-2-methyl-4-nitrobenzene;N-(1-methylethyl)phenazine-1-carboxamide |
| आणविक फार्मूला | C16H15N3O |
| आण्विक वजन | 265.3098 |
| InChI | InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
| कैस रजिस्टी संख्या | 5326-38-5 |
| EINECS | 226-204-1 |
| आणविक संरचना | ![]() |
| घनत्व | 1.217g/cm3 |
| उबलने का समय | 531.5°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.665 |
| फ्लैश प्वाइंट | 275.2°C |
| वाष्प का दबाव | 2.23E-11mmHg at 25°C |
| खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |