ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5326-38-5 2-Iodo-5-nitrotoluene |
|
상품명칭 | 2-Iodo-5-nitrotoluene |
영문 이름 | 2-Iodo-5-nitrotoluene;1-iodo-2-methyl-4-nitrobenzene;N-(1-methylethyl)phenazine-1-carboxamide |
분자식 | C16H15N3O |
분자량 | 265.3098 |
InChI | InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
cas번호 | 5326-38-5 |
EC번호 | 226-204-1 |
분자 구조 | ![]() |
밀도 | 1.217g/cm3 |
비등점 | 531.5°C at 760 mmHg |
굴절 지수 | 1.665 |
인화점 | 275.2°C |
증기압 | 2.23E-11mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |