ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
643-28-7 2-Isopropylaniline |
|
termék neve | 2-Isopropylaniline |
Angol név | 2-Isopropylaniline;2-Aminocumene;2-(1-methylethyl)-benzenamine;2-(propan-2-yl)aniline |
MF | C9H13N |
Molekulatömeg | 135.2062 |
InChI | InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
CAS-szám | 643-28-7 |
EINECS | 211-397-7 |
Molekuláris szerkezete | ![]() |
Sűrűség | 0.953g/cm3 |
Forráspont | 225.6°C at 760 mmHg |
Törésmutató | 1.542 |
Gyulladáspont | 95.6°C |
Gőznyomás | 0.0858mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |