ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
643-28-7 2-Isopropylaniline |
|
상품명칭 | 2-Isopropylaniline |
영문 이름 | 2-Isopropylaniline;2-Aminocumene;2-(1-methylethyl)-benzenamine;2-(propan-2-yl)aniline |
분자식 | C9H13N |
분자량 | 135.2062 |
InChI | InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
cas번호 | 643-28-7 |
EC번호 | 211-397-7 |
분자 구조 | ![]() |
밀도 | 0.953g/cm3 |
비등점 | 225.6°C at 760 mmHg |
굴절 지수 | 1.542 |
인화점 | 95.6°C |
증기압 | 0.0858mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
보안 규칙 | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |