ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
643-28-7 2-Isopropylaniline |
|
उत्पाद का नाम | 2-Isopropylaniline |
अंग्रेज | 2-Isopropylaniline;2-Aminocumene;2-(1-methylethyl)-benzenamine;2-(propan-2-yl)aniline |
आणविक फार्मूला | C9H13N |
आण्विक वजन | 135.2062 |
InChI | InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
कैस रजिस्टी संख्या | 643-28-7 |
EINECS | 211-397-7 |
आणविक संरचना | ![]() |
घनत्व | 0.953g/cm3 |
उबलने का समय | 225.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.542 |
फ्लैश प्वाइंट | 95.6°C |
वाष्प का दबाव | 0.0858mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |