ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
643-28-7 2-Isopropylaniline |
|
שם המוצר | 2-Isopropylaniline |
שם אנגלי | 2-Isopropylaniline;2-Aminocumene;2-(1-methylethyl)-benzenamine;2-(propan-2-yl)aniline |
מולקולרית פורמולה | C9H13N |
משקל מולקולרי | 135.2062 |
InChl | InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
מספר CAS | 643-28-7 |
EINECS | 211-397-7 |
מבנה מולקולרי | ![]() |
צפיפות | 0.953g/cm3 |
נקודת רתיחה | 225.6°C at 760 mmHg |
משקל סגולי | 1.542 |
נקודת הבזק | 95.6°C |
לחץ אדים | 0.0858mmHg at 25°C |
Hazard סימנים | |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |