ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-67-8 4-Chloro-2-fluoro-6-iodoaniline |
|
Nama produk | 4-Chloro-2-fluoro-6-iodoaniline |
Nama bahasa Inggris | 4-Chloro-2-fluoro-6-iodoaniline; |
MF | C6H4ClFIN |
Berat Molekul | 271.4585 |
InChI | InChI=1/C6H4ClFIN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
CAS NO | 216393-67-8 |
Struktur Molekul | ![]() |
Kepadatan | 2.089g/cm3 |
Titik didih | 267.4°C at 760 mmHg |
Indeks bias | 1.665 |
Titik nyala | 115.5°C |
Tekanan uap | 0.00818mmHg at 25°C |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |