ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-67-8 4-Chloro-2-fluoro-6-iodoaniline |
|
اسم المنتج | 4-Chloro-2-fluoro-6-iodoaniline |
الاسم بالانجليزية | 4-Chloro-2-fluoro-6-iodoaniline; |
الصيغة الجزيئية | C6H4ClFIN |
الوزن الجزيئي الغرامي | 271.4585 |
InChI | InChI=1/C6H4ClFIN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
إستراتيجية المساعدة القطرية | 216393-67-8 |
بنية جزيئية | ![]() |
كثافة | 2.089g/cm3 |
نقطة الغليان | 267.4°C at 760 mmHg |
معامل الإنكسار | 1.665 |
نقطة الوميض | 115.5°C |
ضغط البخار | 0.00818mmHg at 25°C |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |