ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-67-8 4-Chloro-2-fluoro-6-iodoaniline |
|
שם המוצר | 4-Chloro-2-fluoro-6-iodoaniline |
שם אנגלי | 4-Chloro-2-fluoro-6-iodoaniline; |
מולקולרית פורמולה | C6H4ClFIN |
משקל מולקולרי | 271.4585 |
InChl | InChI=1/C6H4ClFIN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
מספר CAS | 216393-67-8 |
מבנה מולקולרי | ![]() |
צפיפות | 2.089g/cm3 |
נקודת רתיחה | 267.4°C at 760 mmHg |
משקל סגולי | 1.665 |
נקודת הבזק | 115.5°C |
לחץ אדים | 0.00818mmHg at 25°C |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |