ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-67-8 4-Chloro-2-fluoro-6-iodoaniline |
|
Ürün Adı | 4-Chloro-2-fluoro-6-iodoaniline |
ingilizce adı | 4-Chloro-2-fluoro-6-iodoaniline; |
Moleküler Formülü | C6H4ClFIN |
Molekül Ağırlığı | 271.4585 |
InChI | InChI=1/C6H4ClFIN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
CAS kayıt numarası | 216393-67-8 |
Moleküler Yapısı | ![]() |
Yoğunluk | 2.089g/cm3 |
Kaynama noktası | 267.4°C at 760 mmHg |
Kırılma indisi | 1.665 |
Alevlenme noktası | 115.5°C |
Buhar basıncı | 0.00818mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |