ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
220141-71-9 3,5-Difluorobenzylchloride |
|
| Nama produk | 3,5-Difluorobenzylchloride |
| Nama bahasa Inggris | 3,5-Difluorobenzylchloride;3,5-Difluorobenzyl chloride;1-(chloromethyl)-3,5-difluorobenzene |
| MF | C7H5ClF2 |
| Berat Molekul | 162.5644 |
| InChI | InChI=1/C7H5ClF2/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
| CAS NO | 220141-71-9 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.294g/cm3 |
| Titik didih | 164.5°C at 760 mmHg |
| Indeks bias | 1.485 |
| Titik nyala | 56.2°C |
| Tekanan uap | 2.57mmHg at 25°C |
| Kode Risiko | R34##Causes burns.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |