Chemindex > 220141-71-9
KR ▼
220141-71-9 3,5-Difluorobenzylchloride |
|
| 상품명칭 | 3,5-Difluorobenzylchloride |
| 영문 이름 | 3,5-Difluorobenzylchloride;3,5-Difluorobenzyl chloride;1-(chloromethyl)-3,5-difluorobenzene |
| 분자식 | C7H5ClF2 |
| 분자량 | 162.5644 |
| InChI | InChI=1/C7H5ClF2/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
| cas번호 | 220141-71-9 |
| 분자 구조 |  |
| 밀도 | 1.294g/cm3 |
| 비등점 | 164.5°C at 760 mmHg |
| 굴절 지수 | 1.485 |
| 인화점 | 56.2°C |
| 증기압 | 2.57mmHg at 25°C |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 