ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
220141-71-9 3,5-Difluorobenzylchloride |
|
| produktnavn | 3,5-Difluorobenzylchloride |
| Engelsk navn | 3,5-Difluorobenzylchloride;3,5-Difluorobenzyl chloride;1-(chloromethyl)-3,5-difluorobenzene |
| Molekylær Formel | C7H5ClF2 |
| Molekylvekt | 162.5644 |
| InChI | InChI=1/C7H5ClF2/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
| CAS-nummer | 220141-71-9 |
| Molecular Structure | ![]() |
| Tetthet | 1.294g/cm3 |
| Kokepunkt | 164.5°C at 760 mmHg |
| Brytningsindeks | 1.485 |
| Flammepunktet | 56.2°C |
| Damptrykk | 2.57mmHg at 25°C |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |