ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
220141-71-9 3,5-Difluorobenzylchloride |
|
| שם המוצר | 3,5-Difluorobenzylchloride |
| שם אנגלי | 3,5-Difluorobenzylchloride;3,5-Difluorobenzyl chloride;1-(chloromethyl)-3,5-difluorobenzene |
| מולקולרית פורמולה | C7H5ClF2 |
| משקל מולקולרי | 162.5644 |
| InChl | InChI=1/C7H5ClF2/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
| מספר CAS | 220141-71-9 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.294g/cm3 |
| נקודת רתיחה | 164.5°C at 760 mmHg |
| משקל סגולי | 1.485 |
| נקודת הבזק | 56.2°C |
| לחץ אדים | 2.57mmHg at 25°C |
| סיכונים קודי | R34##Causes burns.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |