Chemindex > 29868-02-8
ID ▼
29868-02-8 asam malat, senyawa dengan 2,2',2''-nitrilotriethanol |
|
| Nama produk | asam malat, senyawa dengan 2,2',2''-nitrilotriethanol |
| Sinonim | Asam butanedioat, 2-hidroksi-, compd.dengan 2,2',2''-nitrilotris(etanol) (1:?); Asam butanedioat, hidroksi-, compd.with 2,2',2''-nitrilotris(etanol); Asam malat, senyawa dengan 2,2',2''-nitrilotriethanol; Asam 2-hidroksibutanadioat - 2,2',2''-nitrilotrietanol (1:1); |
| Nama bahasa Inggris | malic acid, compound with 2,2',2''-nitrilotriethanol;Butanedioic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:?);Butanedioic acid, hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol);Malic acid, compound with 2,2',2''-nitrilotriethanol;2-hydroxybutanedioic acid - 2,2',2''-nitrilotriethanol (1:1) |
| MF | C10H21NO8 |
| Berat Molekul | 283.2756 |
| InChI | InChI=1/C6H15NO3.C4H6O5/c8-4-1-7(2-5-9)3-6-10;5-2(4(8)9)1-3(6)7/h8-10H,1-6H2;2,5H,1H2,(H,6,7)(H,8,9) |
| CAS NO | 29868-02-8 |
| EINECS | 249-904-9 |
| Struktur Molekul |  |
| Titik didih | 335.4°C at 760 mmHg |
| Titik nyala | 185°C |
| Tekanan uap | 8.38E-06mmHg at 25°C |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 29868-02-8 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 