ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29868-02-8 חומצה מאלית, תרכובת עם 2,2',2''-nitrilotriethanol |
|
שם המוצר | חומצה מאלית, תרכובת עם 2,2',2''-nitrilotriethanol |
נרדפות | חומצה בוטנדיואית, 2-הידרוקסי-, compd.עם 2,2',2''-nitrilotris (אתנול) (1:?); חומצה בוטנדיואית, הידרוקסי-, compd.with 2,2',2''-nitrilotris(אתנול); חומצה מאלית, תרכובת עם 2,2',2''-nitrilotriethanol; 2-חומצה הידרוקסי-בוטנדיואית - 2,2',2''-nitrilotriethanol (1:1); |
שם אנגלי | malic acid, compound with 2,2',2''-nitrilotriethanol;Butanedioic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:?);Butanedioic acid, hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol);Malic acid, compound with 2,2',2''-nitrilotriethanol;2-hydroxybutanedioic acid - 2,2',2''-nitrilotriethanol (1:1) |
מולקולרית פורמולה | C10H21NO8 |
משקל מולקולרי | 283.2756 |
InChl | InChI=1/C6H15NO3.C4H6O5/c8-4-1-7(2-5-9)3-6-10;5-2(4(8)9)1-3(6)7/h8-10H,1-6H2;2,5H,1H2,(H,6,7)(H,8,9) |
מספר CAS | 29868-02-8 |
EINECS | 249-904-9 |
מבנה מולקולרי | ![]() |
נקודת רתיחה | 335.4°C at 760 mmHg |
נקודת הבזק | 185°C |
לחץ אדים | 8.38E-06mmHg at 25°C |
MSDS |