Chemindex > 29868-02-8
NO ▼
29868-02-8 eplesyre, forbindelse med 2,2',2''-nitrilotrietanol |
|
| produktnavn | eplesyre, forbindelse med 2,2',2''-nitrilotrietanol |
| Synonymer | Butandisyre, 2-hydroksy-, compd.med 2,2',2''-nitrilotris (etanol) (1:?); Butandisyre, hydroksy-, compd.with 2,2',2''-nitrilotris(etanol); Eplesyre, forbindelse med 2,2',2''-nitrilotrietanol; 2-hydroksybutandisyre - 2,2',2''-nitrilotrietanol (1:1); |
| Engelsk navn | malic acid, compound with 2,2',2''-nitrilotriethanol;Butanedioic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:?);Butanedioic acid, hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol);Malic acid, compound with 2,2',2''-nitrilotriethanol;2-hydroxybutanedioic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molekylær Formel | C10H21NO8 |
| Molekylvekt | 283.2756 |
| InChI | InChI=1/C6H15NO3.C4H6O5/c8-4-1-7(2-5-9)3-6-10;5-2(4(8)9)1-3(6)7/h8-10H,1-6H2;2,5H,1H2,(H,6,7)(H,8,9) |
| CAS-nummer | 29868-02-8 |
| EINECS | 249-904-9 |
| Molecular Structure |  |
| Kokepunkt | 335.4°C at 760 mmHg |
| Flammepunktet | 185°C |
| Damptrykk | 8.38E-06mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 29868-02-8 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 