Chemindex > 29868-02-8
TR ▼
29868-02-8 malik asit, 2,2',2''-nitrilotrietanol ile bileşik |
|
| Ürün Adı | malik asit, 2,2',2''-nitrilotrietanol ile bileşik |
| Eş anlamlı | Bütandioik asit, 2-hidroksi-, compd.2,2',2''-nitrilotris(etanol) (1:?); Bütandioik asit, hidroksi-, 2,2 ', 2 ''-nitrilotris (etanol) ile birlikte; Malik asit, 2,2',2''-nitrilotrioetanol ile bileşik; 2-hidroksibütandioik asit - 2,2',2''-nitrilotrioetanol (1:1); |
| ingilizce adı | malic acid, compound with 2,2',2''-nitrilotriethanol;Butanedioic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:?);Butanedioic acid, hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol);Malic acid, compound with 2,2',2''-nitrilotriethanol;2-hydroxybutanedioic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Moleküler Formülü | C10H21NO8 |
| Molekül Ağırlığı | 283.2756 |
| InChI | InChI=1/C6H15NO3.C4H6O5/c8-4-1-7(2-5-9)3-6-10;5-2(4(8)9)1-3(6)7/h8-10H,1-6H2;2,5H,1H2,(H,6,7)(H,8,9) |
| CAS kayıt numarası | 29868-02-8 |
| EINECS | 249-904-9 |
| Moleküler Yapısı |  |
| Kaynama noktası | 335.4°C at 760 mmHg |
| Alevlenme noktası | 185°C |
| Buhar basıncı | 8.38E-06mmHg at 25°C |
| MSDS | |
- Çin'den kimyasal tedarik etmeyi planlıyorsanız, sadece ChemNet alışveriş merkezine gidin, sizin için Çinli üreticilerden en son ve rekabetçi fiyatı alacağız.Lütfen ziyaret edin
ChemNet Mall
29868-02-8 (0) için tedarikçiler:
Chemical CAS Veritabanı Hizmeti, ChemIndex.com tarafından sağlanmaktadır. 