ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
488-87-9 2,5-Dimethylresorcinol |
|
Nama produk | 2,5-Dimethylresorcinol |
Sinonim | 2,5-dimetilbenzena-1,3-diol; |
Nama bahasa Inggris | 2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
MF | C8H10O2 |
Berat Molekul | 138.1638 |
InChI | InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
CAS NO | 488-87-9 |
EINECS | 207-688-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.162g/cm3 |
Titik lebur | 161℃ |
Titik didih | 284.1°C at 760 mmHg |
Indeks bias | 1.582 |
Titik nyala | 140.8°C |
Tekanan uap | 0.00178mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |