ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
488-87-9 2,5-डाइमिथाइलरेसोर्सिनोल |
|
उत्पाद का नाम | 2,5-डाइमिथाइलरेसोर्सिनोल |
समानार्थी | 2,5-डाइमिथाइलबेनज़ीन-1,3-डायोल; |
अंग्रेज | 2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
आणविक फार्मूला | C8H10O2 |
आण्विक वजन | 138.1638 |
InChI | InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
कैस रजिस्टी संख्या | 488-87-9 |
EINECS | 207-688-3 |
आणविक संरचना | ![]() |
घनत्व | 1.162g/cm3 |
गलनांक | 161℃ |
उबलने का समय | 284.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.582 |
फ्लैश प्वाइंट | 140.8°C |
वाष्प का दबाव | 0.00178mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |