ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
488-87-9 2,5-Dimetilresorsinol |
|
Ürün Adı | 2,5-Dimetilresorsinol |
Eş anlamlı | 2,5-dimetilbenzen-1,3-diol; |
ingilizce adı | 2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
Moleküler Formülü | C8H10O2 |
Molekül Ağırlığı | 138.1638 |
InChI | InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
CAS kayıt numarası | 488-87-9 |
EINECS | 207-688-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.162g/cm3 |
Ergime noktası | 161℃ |
Kaynama noktası | 284.1°C at 760 mmHg |
Kırılma indisi | 1.582 |
Alevlenme noktası | 140.8°C |
Buhar basıncı | 0.00178mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |