ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
488-87-9 2,5-dimetylorezorcynol |
|
Nazwa produktu: | 2,5-dimetylorezorcynol |
Synonimy | 2,5-dimetylobenzeno-1,3-diol; |
Angielska nazwa | 2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
MF | C8H10O2 |
Masie cząsteczkowej | 138.1638 |
InChI | InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
Nr CAS | 488-87-9 |
EINECS | 207-688-3 |
Struktury molekularnej | ![]() |
Gęstość | 1.162g/cm3 |
Temperatura topnienia | 161℃ |
Temperatura wrzenia | 284.1°C at 760 mmHg |
Współczynnik załamania | 1.582 |
Temperatura zapłonu | 140.8°C |
Ciśnienie pary | 0.00178mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |