Chemindex > 5381-99-7
ID ▼
5381-99-7 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
|
| Nama produk | 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
| Nama bahasa Inggris | 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one;2-Chloro-1,3,2-benzodioxaphosphorin-4-one;ChloroHbenzodioxaphosphorinone;2-chloro-4H-1,3,2-benzodioxaphosphinin-4-one |
| MF | C7H4ClO3P |
| Berat Molekul | 202.5316 |
| InChI | InChI=1/C7H4ClO3P/c8-12-10-6-4-2-1-3-5(6)7(9)11-12/h1-4H |
| CAS NO | 5381-99-7 |
| Struktur Molekul |  |
| Titik lebur | 36-128℃ |
| Titik didih | 257.8°C at 760 mmHg |
| Titik nyala | 109.7°C |
| Tekanan uap | 0.0142mmHg at 25°C |
| Simbol bahaya |  C##Corrosive:; |
| Kode Risiko | R14##Reacts violently with water.||R34##Causes burns.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S8##Keep container dry.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 