ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5381-99-7 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
|
Ürün Adı | 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
ingilizce adı | 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one;2-Chloro-1,3,2-benzodioxaphosphorin-4-one;ChloroHbenzodioxaphosphorinone;2-chloro-4H-1,3,2-benzodioxaphosphinin-4-one |
Moleküler Formülü | C7H4ClO3P |
Molekül Ağırlığı | 202.5316 |
InChI | InChI=1/C7H4ClO3P/c8-12-10-6-4-2-1-3-5(6)7(9)11-12/h1-4H |
CAS kayıt numarası | 5381-99-7 |
Moleküler Yapısı | ![]() |
Ergime noktası | 36-128℃ |
Kaynama noktası | 257.8°C at 760 mmHg |
Alevlenme noktası | 109.7°C |
Buhar basıncı | 0.0142mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R14##Reacts violently with water.||R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S8##Keep container dry.:; |
MSDS |