ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5381-99-7 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
|
نام محصول | 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
نام انگلیسی | 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one;2-Chloro-1,3,2-benzodioxaphosphorin-4-one;ChloroHbenzodioxaphosphorinone;2-chloro-4H-1,3,2-benzodioxaphosphinin-4-one |
میدان مغناطیسی | C7H4ClO3P |
وزن مولکولی | 202.5316 |
InChI | InChI=1/C7H4ClO3P/c8-12-10-6-4-2-1-3-5(6)7(9)11-12/h1-4H |
شماره سیایاس | 5381-99-7 |
ساختار مولکولی | ![]() |
نقطه ذوب | 36-128℃ |
نقطه غلیان | 257.8°C at 760 mmHg |
نقطه اشتعال | 109.7°C |
فشار بخار | 0.0142mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R14##Reacts violently with water.||R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S8##Keep container dry.:; |
MSDS |